C42H46N4O10 — CID 59768861
[9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]oxymethoxy]-9H-fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyrimidine-2-carboxylate (PubChem CID 59768861) has the molecular formula C42H46N4O10 and a molecular weight of 766.85 g/mol. Its IUPAC name is [9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]oxymethoxy]-9H-fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyrimidine-2-carboxylate.
| Compound Name | [9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]oxymethoxy]-9H-fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 59768861 |
| Molecular Formula | C42H46N4O10 |
| Molecular Weight | 766.85 g/mol |
| Exact Mass | 766.32 |
| IUPAC Name | [9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]oxymethoxy]-9H-fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyrimidine-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1cnc(OCOc2ccc3c(c2)C(C)c2cc(OC(=O)c4ncc(OCCCCCCOC(=O)C=C)cn4)ccc2-3)nc1 |
| InChI | InChI=1S/C42H46N4O10/c1-4-38(47)52-20-12-8-6-10-18-50-32-24-43-40(44-25-32)41(49)56-31-15-17-35-34-16-14-30(22-36(34)29(3)37(35)23-31)54-28-55-42-45-26-33(27-46-42)51-19-11-7-9-13-21-53-39(48)5-2/h4-5,14-17,22-27,29H,1-2,6-13,18-21,28H2,3H3 |
| InChIKey | ZUAVTHCRMVNNFZ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 167.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.85 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|