About (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+)
(4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) (PubChem CID 21138388) has the molecular formula C18H15NO3W
and a molecular weight of 477.16 g/mol. Its IUPAC name is (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+).
Molecular Properties
| Compound Name | (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) |
| PubChem CID | 21138388 |
| Molecular Formula | C18H15NO3W |
| Molecular Weight | 477.16 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) |
| SMILES | [CH2-]COc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1.[H][C-]=C.[W+2] |
| InChI | InChI=1S/C16H12NO3.C2H3.W/c1-2-19-14-9-5-13(6-10-14)16(18)20-15-7-3-12(11-17)4-8-15;1-2;/h3-10H,1-2H2;1H,2H2;/q2*-1;+2 |
| InChIKey | DNYJUEOOKCTDJS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+)?
The IUPAC name of (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) (CID 21138388) is (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+).
What is the SMILES notation for (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+)?
The canonical SMILES for (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) is [CH2-]COc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1.[H][C-]=C.[W+2].
What is the InChIKey of (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+)?
The InChIKey is DNYJUEOOKCTDJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12NO3.C2H3.W/c1-2-19-14-9-5-13(6-10-14)16(18)20-15-7-3-12(11-17)4-8-15;1-2;/h3-10H,1-2H2;1H,2H2;/q2*-1;+2.
What are the key properties of (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+)?
(4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) has a molecular weight of 477.16 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 4-ethoxybenzoate;ethene;tungsten(2+) is sourced from PubChem (CID 21138388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).