C20H14BrF17OS — CID 87666695
2-bromo-1-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl]butan-1-one (PubChem CID 87666695) has the molecular formula C20H14BrF17OS and a molecular weight of 705.27 g/mol. Its IUPAC name is 2-bromo-1-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl]butan-1-one.
| Compound Name | 2-bromo-1-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 87666695 |
| Molecular Formula | C20H14BrF17OS |
| Molecular Weight | 705.27 g/mol |
| Exact Mass | 703.97 |
| IUPAC Name | 2-bromo-1-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)phenyl]butan-1-one |
| SMILES | CCC(Br)C(=O)c1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14BrF17OS/c1-2-11(21)12(39)9-3-5-10(6-4-9)40-8-7-13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)20(36,37)38/h3-6,11H,2,7-8H2,1H3 |
| InChIKey | VTDNGQBCWZLKLX-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.27 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|