C16H15F2NOS — CID 100922150
1,1-difluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine (PubChem CID 100922150) has the molecular formula C16H15F2NOS and a molecular weight of 307.37 g/mol. Its IUPAC name is 1,1-difluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine.
| Compound Name | 1,1-difluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine |
|---|---|
| PubChem CID | 100922150 |
| Molecular Formula | C16H15F2NOS |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1,1-difluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine |
| SMILES | Cc1ccc(S(=O)C/C(=N/c2ccccc2)C(F)F)cc1 |
| InChI | InChI=1S/C16H15F2NOS/c1-12-7-9-14(10-8-12)21(20)11-15(16(17)18)19-13-5-3-2-4-6-13/h2-10,16H,11H2,1H3/b19-15- |
| InChIKey | HGPZXRFUGDIHGL-CYVLTUHYSA-N |
| XLogP | 4.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|