C18H16F5NO2S — CID 10835109
3,3,4,4,4-pentafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-imine (PubChem CID 10835109) has the molecular formula C18H16F5NO2S and a molecular weight of 405.39 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-imine.
| Compound Name | 3,3,4,4,4-pentafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-imine |
|---|---|
| PubChem CID | 10835109 |
| Molecular Formula | C18H16F5NO2S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]butan-2-imine |
| SMILES | COc1ccc(/N=C(\C[S@@](=O)c2ccc(C)cc2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F5NO2S/c1-12-3-9-15(10-4-12)27(25)11-16(17(19,20)18(21,22)23)24-13-5-7-14(26-2)8-6-13/h3-10H,11H2,1-2H3/b24-16+/t27-/m1/s1 |
| InChIKey | IIBSRLBRRQDYGA-HTCWZNLXSA-N |
| XLogP | 5.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|