C15H14BrN3O3S — CID 2308356
ethyl 2-amino-5-[[(4-bromobenzoyl)hydrazinylidene]methyl]thiophene-3-carboxylate (PubChem CID 2308356) has the molecular formula C15H14BrN3O3S and a molecular weight of 396.27 g/mol. Its IUPAC name is ethyl 2-amino-5-[[(4-bromobenzoyl)hydrazinylidene]methyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-5-[[(4-bromobenzoyl)hydrazinylidene]methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2308356 |
| Molecular Formula | C15H14BrN3O3S |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | ethyl 2-amino-5-[[(4-bromobenzoyl)hydrazinylidene]methyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C=NNC(=O)c2ccc(Br)cc2)sc1N |
| InChI | InChI=1S/C15H14BrN3O3S/c1-2-22-15(21)12-7-11(23-13(12)17)8-18-19-14(20)9-3-5-10(16)6-4-9/h3-8H,2,17H2,1H3,(H,19,20) |
| InChIKey | BXCOZNDHRSQIKU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|