C20H24O8 — CID 5254678
diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate (PubChem CID 5254678) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate.
| Compound Name | diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate |
|---|---|
| PubChem CID | 5254678 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=c1ccc(=C(C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C20H24O8/c1-5-25-17(21)15(18(22)26-6-2)13-9-11-14(12-10-13)16(19(23)27-7-3)20(24)28-8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | XNHBIARQPPZVKL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|