C11H15NO4S — CID 11054312
diethyl 2-(5-methyl-3H-1,3-thiazol-2-ylidene)propanedioate (PubChem CID 11054312) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is diethyl 2-(5-methyl-3H-1,3-thiazol-2-ylidene)propanedioate.
| Compound Name | diethyl 2-(5-methyl-3H-1,3-thiazol-2-ylidene)propanedioate |
|---|---|
| PubChem CID | 11054312 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | diethyl 2-(5-methyl-3H-1,3-thiazol-2-ylidene)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1NC=C(C)S1 |
| InChI | InChI=1S/C11H15NO4S/c1-4-15-10(13)8(11(14)16-5-2)9-12-6-7(3)17-9/h6,12H,4-5H2,1-3H3 |
| InChIKey | ZWWAIUHGCNRXNA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|