C10H14O5S2 — CID 12801576
diethyl 2-(4-hydroxy-1,3-dithiolan-2-ylidene)propanedioate (PubChem CID 12801576) has the molecular formula C10H14O5S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is diethyl 2-(4-hydroxy-1,3-dithiolan-2-ylidene)propanedioate.
| Compound Name | diethyl 2-(4-hydroxy-1,3-dithiolan-2-ylidene)propanedioate |
|---|---|
| PubChem CID | 12801576 |
| Molecular Formula | C10H14O5S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | diethyl 2-(4-hydroxy-1,3-dithiolan-2-ylidene)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1SCC(O)S1 |
| InChI | InChI=1S/C10H14O5S2/c1-3-14-8(12)7(9(13)15-4-2)10-16-5-6(11)17-10/h6,11H,3-5H2,1-2H3 |
| InChIKey | NOOLHWYXJIBNMY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|