C6H10O2S2 — CID 13461147
1,3-dithiolan-2-ylidene(ethoxy)methanol (PubChem CID 13461147) has the molecular formula C6H10O2S2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1,3-dithiolan-2-ylidene(ethoxy)methanol.
| Compound Name | 1,3-dithiolan-2-ylidene(ethoxy)methanol |
|---|---|
| PubChem CID | 13461147 |
| Molecular Formula | C6H10O2S2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 1,3-dithiolan-2-ylidene(ethoxy)methanol |
| SMILES | CCOC(O)=C1SCCS1 |
| InChI | InChI=1S/C6H10O2S2/c1-2-8-5(7)6-9-3-4-10-6/h7H,2-4H2,1H3 |
| InChIKey | APZNICYWHTWPIS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|