C7H9O2S4- — CID 100920952
6-ethoxycarbonylsulfanyl-2,3-dihydro-1,4-dithiine-5-thiolate (PubChem CID 100920952) has the molecular formula C7H9O2S4- and a molecular weight of 253.41 g/mol. Its IUPAC name is 6-ethoxycarbonylsulfanyl-2,3-dihydro-1,4-dithiine-5-thiolate.
| Compound Name | 6-ethoxycarbonylsulfanyl-2,3-dihydro-1,4-dithiine-5-thiolate |
|---|---|
| PubChem CID | 100920952 |
| Molecular Formula | C7H9O2S4- |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 6-ethoxycarbonylsulfanyl-2,3-dihydro-1,4-dithiine-5-thiolate |
| SMILES | CCOC(=O)SC1=C([S-])SCCS1 |
| InChI | InChI=1S/C7H10O2S4/c1-2-9-7(8)13-6-5(10)11-3-4-12-6/h10H,2-4H2,1H3/p-1 |
| InChIKey | LCRWELGFOQMAGJ-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|