C14H13FO3S2 — CID 135002640
ethyl 2-(1,3-dithiolan-2-ylidene)-3-(2-fluorophenyl)-3-oxopropanoate (PubChem CID 135002640) has the molecular formula C14H13FO3S2 and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 2-(1,3-dithiolan-2-ylidene)-3-(2-fluorophenyl)-3-oxopropanoate.
| Compound Name | ethyl 2-(1,3-dithiolan-2-ylidene)-3-(2-fluorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 135002640 |
| Molecular Formula | C14H13FO3S2 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | ethyl 2-(1,3-dithiolan-2-ylidene)-3-(2-fluorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(=O)c1ccccc1F)=C1SCCS1 |
| InChI | InChI=1S/C14H13FO3S2/c1-2-18-13(17)11(14-19-7-8-20-14)12(16)9-5-3-4-6-10(9)15/h3-6H,2,7-8H2,1H3 |
| InChIKey | SMOGYWRERNIBTF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|