C20H20N2O2S2 — CID 73427288
ethyl 4-[[1,3-dithian-2-ylidene(phenyl)methyl]diazenyl]benzoate (PubChem CID 73427288) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is ethyl 4-[[1,3-dithian-2-ylidene(phenyl)methyl]diazenyl]benzoate.
| Compound Name | ethyl 4-[[1,3-dithian-2-ylidene(phenyl)methyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 73427288 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | ethyl 4-[[1,3-dithian-2-ylidene(phenyl)methyl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/C(=C2SCCCS2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-2-24-19(23)16-9-11-17(12-10-16)21-22-18(15-7-4-3-5-8-15)20-25-13-6-14-26-20/h3-5,7-12H,2,6,13-14H2,1H3/b22-21+ |
| InChIKey | OHDRPYNAGNRNNM-QURGRASLSA-N |
| XLogP | 6.14 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|