C12H6F12O2 — CID 5246928
ethoxy-[2,3,4,5-tetrakis(trifluoromethyl)cyclopenta-2,4-dien-1-ylidene]methanol (PubChem CID 5246928) has the molecular formula C12H6F12O2 and a molecular weight of 410.15 g/mol. Its IUPAC name is ethoxy-[2,3,4,5-tetrakis(trifluoromethyl)cyclopenta-2,4-dien-1-ylidene]methanol.
| Compound Name | ethoxy-[2,3,4,5-tetrakis(trifluoromethyl)cyclopenta-2,4-dien-1-ylidene]methanol |
|---|---|
| PubChem CID | 5246928 |
| Molecular Formula | C12H6F12O2 |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | ethoxy-[2,3,4,5-tetrakis(trifluoromethyl)cyclopenta-2,4-dien-1-ylidene]methanol |
| SMILES | CCOC(O)=C1C(C(F)(F)F)=C(C(F)(F)F)C(C(F)(F)F)=C1C(F)(F)F |
| InChI | InChI=1S/C12H6F12O2/c1-2-26-8(25)3-4(9(13,14)15)6(11(19,20)21)7(12(22,23)24)5(3)10(16,17)18/h25H,2H2,1H3 |
| InChIKey | ZSUMBAVDYQTCDB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|