C14H17KO8S2 — CID 23693345
potassium 4-[[2-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)-1,3-dithiolan-4-yl]oxy]-4-oxobutanoate (PubChem CID 23693345) has the molecular formula C14H17KO8S2 and a molecular weight of 416.51 g/mol. Its IUPAC name is potassium 4-[[2-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)-1,3-dithiolan-4-yl]oxy]-4-oxobutanoate.
| Compound Name | potassium 4-[[2-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)-1,3-dithiolan-4-yl]oxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 23693345 |
| Molecular Formula | C14H17KO8S2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | potassium 4-[[2-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)-1,3-dithiolan-4-yl]oxy]-4-oxobutanoate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1SCC(OC(=O)CCC(=O)[O-])S1.[K+] |
| InChI | InChI=1S/C14H18O8S2.K/c1-3-20-12(18)11(13(19)21-4-2)14-23-7-10(24-14)22-9(17)6-5-8(15)16;/h10H,3-7H2,1-2H3,(H,15,16);/q;+1/p-1 |
| InChIKey | UQMQPUIABQCXCE-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|