C17H15BrN2O2 — CID 101441131
ethyl 4-(4-bromophenyl)-5,5-dicyanocyclohexene-1-carboxylate (PubChem CID 101441131) has the molecular formula C17H15BrN2O2 and a molecular weight of 359.22 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-5,5-dicyanocyclohexene-1-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-5,5-dicyanocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 101441131 |
| Molecular Formula | C17H15BrN2O2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-5,5-dicyanocyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC(c2ccc(Br)cc2)C(C#N)(C#N)C1 |
| InChI | InChI=1S/C17H15BrN2O2/c1-2-22-16(21)13-5-8-15(17(9-13,10-19)11-20)12-3-6-14(18)7-4-12/h3-7,15H,2,8-9H2,1H3 |
| InChIKey | BCBILTOHDQRLJS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |