C26H25NO5 — CID 57381733
diethyl (1S,5R,6R)-6-benzoyl-6-cyano-5-phenylcyclohex-2-ene-1,2-dicarboxylate (PubChem CID 57381733) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is diethyl (1S,5R,6R)-6-benzoyl-6-cyano-5-phenylcyclohex-2-ene-1,2-dicarboxylate.
| Compound Name | diethyl (1S,5R,6R)-6-benzoyl-6-cyano-5-phenylcyclohex-2-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57381733 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | diethyl (1S,5R,6R)-6-benzoyl-6-cyano-5-phenylcyclohex-2-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=CC[C@H](c2ccccc2)[C@@](C#N)(C(=O)c2ccccc2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C26H25NO5/c1-3-31-24(29)20-15-16-21(18-11-7-5-8-12-18)26(17-27,22(20)25(30)32-4-2)23(28)19-13-9-6-10-14-19/h5-15,21-22H,3-4,16H2,1-2H3/t21-,22+,26-/m1/s1 |
| InChIKey | KFXPFTFBOVTKBY-TVZXLZGTSA-N |
| XLogP | 4.24 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |