C15H14BrNO2 — CID 6949403
(3aS,7aS)-2-(4-bromophenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6949403) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is (3aS,7aS)-2-(4-bromophenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-(4-bromophenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6949403 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (3aS,7aS)-2-(4-bromophenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C[C@]12CC=CC[C@@H]1C(=O)N(c1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C15H14BrNO2/c1-15-9-3-2-4-12(15)13(18)17(14(15)19)11-7-5-10(16)6-8-11/h2-3,5-8,12H,4,9H2,1H3/t12-,15+/m1/s1 |
| InChIKey | DZAMMUDSEINOHR-DOMZBBRYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|