C29H29NO2 — CID 42649077
(4-ethynyl-4-hydroxy-2,6-diphenyl-3-propylpiperidin-1-yl)-phenylmethanone (PubChem CID 42649077) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (4-ethynyl-4-hydroxy-2,6-diphenyl-3-propylpiperidin-1-yl)-phenylmethanone.
| Compound Name | (4-ethynyl-4-hydroxy-2,6-diphenyl-3-propylpiperidin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 42649077 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (4-ethynyl-4-hydroxy-2,6-diphenyl-3-propylpiperidin-1-yl)-phenylmethanone |
| SMILES | C#CC1(O)CC(c2ccccc2)N(C(=O)c2ccccc2)C(c2ccccc2)C1CCC |
| InChI | InChI=1S/C29H29NO2/c1-3-14-25-27(23-17-10-6-11-18-23)30(28(31)24-19-12-7-13-20-24)26(21-29(25,32)4-2)22-15-8-5-9-16-22/h2,5-13,15-20,25-27,32H,3,14,21H2,1H3 |
| InChIKey | ACZBXOYGOCABQK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|