C29H27NO2 — CID 23622450
[(1R,2R,4S,5S)-9-ethynyl-9-hydroxy-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-3-yl]-phenylmethanone (PubChem CID 23622450) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is [(1R,2R,4S,5S)-9-ethynyl-9-hydroxy-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-3-yl]-phenylmethanone.
| Compound Name | [(1R,2R,4S,5S)-9-ethynyl-9-hydroxy-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 23622450 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [(1R,2R,4S,5S)-9-ethynyl-9-hydroxy-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-3-yl]-phenylmethanone |
| SMILES | C#CC1(O)[C@@H]2CCC[C@H]1[C@@H](c1ccccc1)N(C(=O)c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C29H27NO2/c1-2-29(32)24-19-12-20-25(29)27(22-15-8-4-9-16-22)30(26(24)21-13-6-3-7-14-21)28(31)23-17-10-5-11-18-23/h1,3-11,13-18,24-27,32H,12,19-20H2/t24-,25+,26+,27-,29? |
| InChIKey | SBDCSSFKGJMKST-IJVNMGGGSA-N |
| XLogP | 5.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|