C35H30N2O — CID 124717984
(2R,3S,5S,6S,8R,10S)-4-ethynyl-2,6,8,10-tetraphenyl-1,7-diazatetracyclo[5.3.1.03,9.05,9]undecan-4-ol (PubChem CID 124717984) has the molecular formula C35H30N2O and a molecular weight of 494.64 g/mol. Its IUPAC name is (2R,3S,5S,6S,8R,10S)-4-ethynyl-2,6,8,10-tetraphenyl-1,7-diazatetracyclo[5.3.1.03,9.05,9]undecan-4-ol.
| Compound Name | (2R,3S,5S,6S,8R,10S)-4-ethynyl-2,6,8,10-tetraphenyl-1,7-diazatetracyclo[5.3.1.03,9.05,9]undecan-4-ol |
|---|---|
| PubChem CID | 124717984 |
| Molecular Formula | C35H30N2O |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (2R,3S,5S,6S,8R,10S)-4-ethynyl-2,6,8,10-tetraphenyl-1,7-diazatetracyclo[5.3.1.03,9.05,9]undecan-4-ol |
| SMILES | C#CC1(O)[C@@H]2[C@@H](c3ccccc3)N3CN4[C@@H](c5ccccc5)C2([C@H]3c2ccccc2)[C@H]1[C@@H]4c1ccccc1 |
| InChI | InChI=1S/C35H30N2O/c1-2-34(38)30-28(24-15-7-3-8-16-24)36-23-37-29(25-17-9-4-10-18-25)31(34)35(30,32(36)26-19-11-5-12-20-26)33(37)27-21-13-6-14-22-27/h1,3-22,28-33,38H,23H2/t28-,29+,30-,31-,32-,33+,34?,35?/m0/s1 |
| InChIKey | APLDYJHJWKOWPY-DOVVWUGUSA-N |
| XLogP | 6.15 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|