About 9,10-diethynylanthracene-9,10-diol
9,10-diethynylanthracene-9,10-diol (PubChem CID 139175436) has the molecular formula C36H24O4
and a molecular weight of 520.58 g/mol. Its IUPAC name is 9,10-diethynylanthracene-9,10-diol.
Molecular Properties
| Compound Name | 9,10-diethynylanthracene-9,10-diol |
| PubChem CID | 139175436 |
| Molecular Formula | C36H24O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 9,10-diethynylanthracene-9,10-diol |
| SMILES | C#C[C@]1(O)c2ccccc2[C@@](O)(C#C)c2ccccc21.C#C[C@]1(O)c2ccccc2[C@@](O)(C#C)c2ccccc21 |
| InChI | InChI=1S/2C18H12O2/c2*1-3-17(19)13-9-5-7-11-15(13)18(20,4-2)16-12-8-6-10-14(16)17/h2*1-2,5-12,19-20H/t2*17-,18- |
| InChIKey | ZXNGEONGFDVZMK-KKZDJAMHSA-N |
| XLogP | 3.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9,10-diethynylanthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-diethynylanthracene-9,10-diol?
The IUPAC name of 9,10-diethynylanthracene-9,10-diol (CID 139175436) is 9,10-diethynylanthracene-9,10-diol.
What is the SMILES notation for 9,10-diethynylanthracene-9,10-diol?
The canonical SMILES for 9,10-diethynylanthracene-9,10-diol is C#C[C@]1(O)c2ccccc2[C@@](O)(C#C)c2ccccc21.C#C[C@]1(O)c2ccccc2[C@@](O)(C#C)c2ccccc21.
What is the InChIKey of 9,10-diethynylanthracene-9,10-diol?
The InChIKey is ZXNGEONGFDVZMK-KKZDJAMHSA-N. The full InChI is InChI=1S/2C18H12O2/c2*1-3-17(19)13-9-5-7-11-15(13)18(20,4-2)16-12-8-6-10-14(16)17/h2*1-2,5-12,19-20H/t2*17-,18-.
What are the key properties of 9,10-diethynylanthracene-9,10-diol?
9,10-diethynylanthracene-9,10-diol has a molecular weight of 520.58 g/mol, XLogP of 3.48, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-diethynylanthracene-9,10-diol is sourced from PubChem (CID 139175436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).