C36H24O4 — CID 139175436
9,10-diethynylanthracene-9,10-diol (PubChem CID 139175436) has the molecular formula C36H24O4 and a molecular weight of 520.58 g/mol. Its IUPAC name is 9,10-diethynylanthracene-9,10-diol.
| Compound Name | 9,10-diethynylanthracene-9,10-diol |
|---|---|
| PubChem CID | 139175436 |
| Molecular Formula | C36H24O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 9,10-diethynylanthracene-9,10-diol |
| SMILES | C#C[C@]1(O)c2ccccc2[C@@](O)(C#C)c2ccccc21.C#C[C@]1(O)c2ccccc2[C@@](O)(C#C)c2ccccc21 |
| InChI | InChI=1S/2C18H12O2/c2*1-3-17(19)13-9-5-7-11-15(13)18(20,4-2)16-12-8-6-10-14(16)17/h2*1-2,5-12,19-20H/t2*17-,18- |
| InChIKey | ZXNGEONGFDVZMK-KKZDJAMHSA-N |
| XLogP | 3.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|