C18H10Cl2O2 — CID 102183256
(1R,4R)-2,3-dichloro-1,4-diethynylanthracene-1,4-diol (PubChem CID 102183256) has the molecular formula C18H10Cl2O2 and a molecular weight of 329.18 g/mol. Its IUPAC name is (1R,4R)-2,3-dichloro-1,4-diethynylanthracene-1,4-diol.
| Compound Name | (1R,4R)-2,3-dichloro-1,4-diethynylanthracene-1,4-diol |
|---|---|
| PubChem CID | 102183256 |
| Molecular Formula | C18H10Cl2O2 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | (1R,4R)-2,3-dichloro-1,4-diethynylanthracene-1,4-diol |
| SMILES | C#C[C@]1(O)C(Cl)=C(Cl)[C@@](O)(C#C)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C18H10Cl2O2/c1-3-17(21)13-9-11-7-5-6-8-12(11)10-14(13)18(22,4-2)16(20)15(17)19/h1-2,5-10,21-22H/t17-,18-/m1/s1 |
| InChIKey | WFJHGULIQODROV-QZTJIDSGSA-N |
| XLogP | 3.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|