About 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol
4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol (PubChem CID 126721359) has the molecular formula C25H28O2
and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol.
Molecular Properties
| Compound Name | 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol |
| PubChem CID | 126721359 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol |
| SMILES | C#CC(O)C(CC)CCCC.C#CC1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H10O.C10H18O/c1-2-15(16)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-4-7-8-9(5-2)10(11)6-3/h1,3-10,16H;3,9-11H,4-5,7-8H2,1-2H3 |
| InChIKey | IWAMUWIKPBLJFK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol?
The IUPAC name of 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol (CID 126721359) is 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol.
What is the SMILES notation for 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol?
The canonical SMILES for 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol is C#CC(O)C(CC)CCCC.C#CC1(O)c2ccccc2-c2ccccc21.
What is the InChIKey of 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol?
The InChIKey is IWAMUWIKPBLJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O.C10H18O/c1-2-15(16)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-4-7-8-9(5-2)10(11)6-3/h1,3-10,16H;3,9-11H,4-5,7-8H2,1-2H3.
What are the key properties of 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol?
4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol has a molecular weight of 360.50 g/mol, XLogP of 4.73, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyloct-1-yn-3-ol;9-ethynylfluoren-9-ol is sourced from PubChem (CID 126721359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).