C18H15IO — CID 138624557
2-ethynyl-5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol (PubChem CID 138624557) has the molecular formula C18H15IO and a molecular weight of 374.22 g/mol. Its IUPAC name is 2-ethynyl-5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol.
| Compound Name | 2-ethynyl-5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol |
|---|---|
| PubChem CID | 138624557 |
| Molecular Formula | C18H15IO |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-ethynyl-5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol |
| SMILES | C#CC1(O)c2cc(C)ccc2CCc2ccc(I)cc21 |
| InChI | InChI=1S/C18H15IO/c1-3-18(20)16-10-12(2)4-5-13(16)6-7-14-8-9-15(19)11-17(14)18/h1,4-5,8-11,20H,6-7H2,2H3 |
| InChIKey | HXZMIMLCFUDYTI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|