C18H19NS2 — CID 59155745
1-methyl-2,6-diphenyl-3,6-dihydro-2H-pyridine-4,5-dithiol (PubChem CID 59155745) has the molecular formula C18H19NS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-methyl-2,6-diphenyl-3,6-dihydro-2H-pyridine-4,5-dithiol.
| Compound Name | 1-methyl-2,6-diphenyl-3,6-dihydro-2H-pyridine-4,5-dithiol |
|---|---|
| PubChem CID | 59155745 |
| Molecular Formula | C18H19NS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-methyl-2,6-diphenyl-3,6-dihydro-2H-pyridine-4,5-dithiol |
| SMILES | CN1C(c2ccccc2)CC(S)=C(S)C1c1ccccc1 |
| InChI | InChI=1S/C18H19NS2/c1-19-15(13-8-4-2-5-9-13)12-16(20)18(21)17(19)14-10-6-3-7-11-14/h2-11,15,17,20-21H,12H2,1H3 |
| InChIKey | POOFCXDOXMAHJY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|