C18H21NO7S — CID 57386989
[2-(4-nitrophenyl)-2-oxoethyl] [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate (PubChem CID 57386989) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
|---|---|
| PubChem CID | 57386989 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)OCC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)C2 |
| InChI | InChI=1S/C18H21NO7S/c1-17(2)13-7-8-18(17,16(21)9-13)11-27(24,25)26-10-15(20)12-3-5-14(6-4-12)19(22)23/h3-6,13H,7-11H2,1-2H3/t13-,18-/m0/s1 |
| InChIKey | FBQPMCUBCZSZMG-UGSOOPFHSA-N |
| XLogP | 2.52 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|