C37H54O7S2Si3 — CID 139752126
[tris(3-trimethylsilyloxyphenyl)-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 139752126) has the molecular formula C37H54O7S2Si3 and a molecular weight of 759.22 g/mol. Its IUPAC name is [tris(3-trimethylsilyloxyphenyl)-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [tris(3-trimethylsilyloxyphenyl)-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 139752126 |
| Molecular Formula | C37H54O7S2Si3 |
| Molecular Weight | 759.22 g/mol |
| Exact Mass | 758.26 |
| IUPAC Name | [tris(3-trimethylsilyloxyphenyl)-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)OS(c1cccc(O[Si](C)(C)C)c1)(c1cccc(O[Si](C)(C)C)c1)c1cccc(O[Si](C)(C)C)c1)C(=O)C2 |
| InChI | InChI=1S/C37H54O7S2Si3/c1-36(2)28-21-22-37(36,35(38)23-28)27-45(39,40)44-46(32-18-12-15-29(24-32)41-47(3,4)5,33-19-13-16-30(25-33)42-48(6,7)8)34-20-14-17-31(26-34)43-49(9,10)11/h12-20,24-26,28H,21-23,27H2,1-11H3 |
| InChIKey | ZFMFPCQZSNRYRP-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.22 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|