C14H16ClNS — CID 175673340
3-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride (PubChem CID 175673340) has the molecular formula C14H16ClNS and a molecular weight of 265.81 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride.
| Compound Name | 3-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride |
|---|---|
| PubChem CID | 175673340 |
| Molecular Formula | C14H16ClNS |
| Molecular Weight | 265.81 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride |
| SMILES | Cc1ccc(Sc2cccc(N)c2)c(C)c1.Cl |
| InChI | InChI=1S/C14H15NS.ClH/c1-10-6-7-14(11(2)8-10)16-13-5-3-4-12(15)9-13;/h3-9H,15H2,1-2H3;1H |
| InChIKey | OWGNOFSANOGBJP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|