C18H22N2O4S2 — CID 9243979
2-(3,4-dimethylphenyl)sulfanyl-N'-(4-ethoxyphenyl)sulfonylacetohydrazide (PubChem CID 9243979) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-N'-(4-ethoxyphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-N'-(4-ethoxyphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 9243979 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-N'-(4-ethoxyphenyl)sulfonylacetohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)CSc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-4-24-15-6-9-17(10-7-15)26(22,23)20-19-18(21)12-25-16-8-5-13(2)14(3)11-16/h5-11,20H,4,12H2,1-3H3,(H,19,21) |
| InChIKey | JICAIPMQNQXFFQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|