C18H19N3O5S — CID 9427644
3-(1,3-benzoxazol-2-yl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide (PubChem CID 9427644) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 9427644 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)CCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-2-25-13-7-9-14(10-8-13)27(23,24)21-20-17(22)11-12-18-19-15-5-3-4-6-16(15)26-18/h3-10,21H,2,11-12H2,1H3,(H,20,22) |
| InChIKey | IYSYWZNGFJJJGZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|