C11H16F2N2O4S — CID 114384146
N-(3-amino-2,2-difluoropropyl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 114384146) has the molecular formula C11H16F2N2O4S and a molecular weight of 310.32 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114384146 |
| Molecular Formula | C11H16F2N2O4S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(F)(F)CN)cc1OC |
| InChI | InChI=1S/C11H16F2N2O4S/c1-18-9-4-3-8(5-10(9)19-2)20(16,17)15-7-11(12,13)6-14/h3-5,15H,6-7,14H2,1-2H3 |
| InChIKey | MWZFGBHJSCBTJZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |