C11H16F2N2O3S — CID 114383933
N-(3-amino-2,2-difluoropropyl)-4-ethoxybenzenesulfonamide (PubChem CID 114383933) has the molecular formula C11H16F2N2O3S and a molecular weight of 294.32 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-4-ethoxybenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114383933 |
| Molecular Formula | C11H16F2N2O3S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(F)(F)CN)cc1 |
| InChI | InChI=1S/C11H16F2N2O3S/c1-2-18-9-3-5-10(6-4-9)19(16,17)15-8-11(12,13)7-14/h3-6,15H,2,7-8,14H2,1H3 |
| InChIKey | ASMMTEVTPBOXMF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |