C14H21NO6S — CID 97307640
ethyl (2R)-3-[(4-ethoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoate (PubChem CID 97307640) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is ethyl (2R)-3-[(4-ethoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoate.
| Compound Name | ethyl (2R)-3-[(4-ethoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 97307640 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | ethyl (2R)-3-[(4-ethoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoate |
| SMILES | CCOC(=O)[C@](C)(O)CNS(=O)(=O)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C14H21NO6S/c1-4-20-11-6-8-12(9-7-11)22(18,19)15-10-14(3,17)13(16)21-5-2/h6-9,15,17H,4-5,10H2,1-3H3/t14-/m1/s1 |
| InChIKey | GRNYCVAJISKCJR-CQSZACIVSA-N |
| XLogP | 0.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |