C10H14ClNO5S2 — CID 97307644
ethyl (2S)-3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxy-2-methylpropanoate (PubChem CID 97307644) has the molecular formula C10H14ClNO5S2 and a molecular weight of 327.81 g/mol. Its IUPAC name is ethyl (2S)-3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxy-2-methylpropanoate.
| Compound Name | ethyl (2S)-3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 97307644 |
| Molecular Formula | C10H14ClNO5S2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | ethyl (2S)-3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxy-2-methylpropanoate |
| SMILES | CCOC(=O)[C@@](C)(O)CNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO5S2/c1-3-17-9(13)10(2,14)6-12-19(15,16)8-5-4-7(11)18-8/h4-5,12,14H,3,6H2,1-2H3/t10-/m0/s1 |
| InChIKey | SAOKSQVDCYFHAN-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |