C15H19NO5S — CID 121085972
4-ethoxy-N-[2-(furan-2-yl)-2-hydroxypropyl]benzenesulfonamide (PubChem CID 121085972) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(furan-2-yl)-2-hydroxypropyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[2-(furan-2-yl)-2-hydroxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121085972 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-ethoxy-N-[2-(furan-2-yl)-2-hydroxypropyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(C)(O)c2ccco2)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-3-20-12-6-8-13(9-7-12)22(18,19)16-11-15(2,17)14-5-4-10-21-14/h4-10,16-17H,3,11H2,1-2H3 |
| InChIKey | AMBYHNYXIHIKJV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |