C15H19NO4S — CID 53279766
4-ethoxy-N-[3-(furan-2-yl)propyl]benzenesulfonamide (PubChem CID 53279766) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-ethoxy-N-[3-(furan-2-yl)propyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[3-(furan-2-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53279766 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-ethoxy-N-[3-(furan-2-yl)propyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCCc2ccco2)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-2-19-14-7-9-15(10-8-14)21(17,18)16-11-3-5-13-6-4-12-20-13/h4,6-10,12,16H,2-3,5,11H2,1H3 |
| InChIKey | KBTAQCCBGNQBOJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|