C21H23N3O6S2 — CID 29354790
4-[(Z)-N-[(4-ethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 29354790) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[(Z)-N-[(4-ethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[(Z)-N-[(4-ethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 29354790 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 4-[(Z)-N-[(4-ethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C(/C)c2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O6S2/c1-3-29-18-8-12-21(13-9-18)32(27,28)24-23-16(2)17-6-10-20(11-7-17)31(25,26)22-15-19-5-4-14-30-19/h4-14,22,24H,3,15H2,1-2H3/b23-16- |
| InChIKey | HPQCXZBPPTVWNK-KQWNVCNZSA-N |
| XLogP | 2.86 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|