C12H14ClN3O4S — CID 43415198
5-chloro-N-(2,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide (PubChem CID 43415198) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-(2,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 43415198 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-chloro-N-(2,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ncn(C)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C12H14ClN3O4S/c1-16-7-14-12(11(16)13)21(17,18)15-9-5-4-8(19-2)6-10(9)20-3/h4-7,15H,1-3H3 |
| InChIKey | MWNWDOGXAUQOIB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |