C12H7ClF3NO3S — CID 81422193
N-(4-chloro-2-hydroxyphenyl)-2,4,6-trifluorobenzenesulfonamide (PubChem CID 81422193) has the molecular formula C12H7ClF3NO3S and a molecular weight of 337.71 g/mol. Its IUPAC name is N-(4-chloro-2-hydroxyphenyl)-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(4-chloro-2-hydroxyphenyl)-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 81422193 |
| Molecular Formula | C12H7ClF3NO3S |
| Molecular Weight | 337.71 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | N-(4-chloro-2-hydroxyphenyl)-2,4,6-trifluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H7ClF3NO3S/c13-6-1-2-10(11(18)3-6)17-21(19,20)12-8(15)4-7(14)5-9(12)16/h1-5,17-18H |
| InChIKey | SIYYGRJFBSAEOL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|