2-chloro-5-(cyclopropylsulfonylamino)benzoic acid

C10H10ClNO4S — CID 62998220

IUPAC2-chloro-5-(cyclopropylsulfonylamino)benzoic acid
SMILESO=C(O)c1cc(NS(=O)(=O)C2CC2)ccc1Cl
InChIInChI=1S/C10H10ClNO4S/c11-9-4-1-6(5-8(9)10(13)14)12-17(15,16)7-2-3-7/h1,4-5,7,12H,2-3H2,(H,13,14)
InChIKeyZXVBADCIQYQKNR-UHFFFAOYSA-N
MW275.71 g/mol
LogP1.94
Rot. Bonds4

About 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid

2-chloro-5-(cyclopropylsulfonylamino)benzoic acid (PubChem CID 62998220) has the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. Its IUPAC name is 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid.

Molecular Properties

Compound Name2-chloro-5-(cyclopropylsulfonylamino)benzoic acid
PubChem CID62998220
Molecular FormulaC10H10ClNO4S
Molecular Weight275.71 g/mol
Exact Mass275.00
IUPAC Name2-chloro-5-(cyclopropylsulfonylamino)benzoic acid
SMILESO=C(O)c1cc(NS(=O)(=O)C2CC2)ccc1Cl
InChIInChI=1S/C10H10ClNO4S/c11-9-4-1-6(5-8(9)10(13)14)12-17(15,16)7-2-3-7/h1,4-5,7,12H,2-3H2,(H,13,14)
InChIKeyZXVBADCIQYQKNR-UHFFFAOYSA-N
XLogP1.94
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.71
LogP ≤ 51.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-chloro-5-(sulfoamino)benzoic acid
CID 169095231
N-(3-chlorophenyl)cyclopropanesulfonamide
CID 45497298
3-chloro-2-(cyclohexylsulfonylamino)benzoic acid
CID 107049283
2-chloro-5-[(2-methylpiperidin-1-yl)sulfonylamino]benzoic acid
CID 60862727
3-chloro-4-(cyclopropylsulfonylamino)benzoic acid
CID 64552202
2-chloro-5-(cyclohexylamino)benzoic acid
CID 43736277
2-chloro-5-(prop-2-enylsulfonylamino)benzoic acid
CID 79673875
2-chloro-5-(cyclooctanecarbonylamino)benzoic acid
CID 65019289
2-chloro-5-(cycloheptanecarbonylamino)benzoic acid
CID 62587194
4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybenzoic acid
CID 43361376
2-chloro-5-[(2,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid
CID 51133066
2-chloro-5-[(3-fluorophenyl)sulfonylamino]benzoic acid
CID 51118457

Frequently Asked Questions

What is the IUPAC name of 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid?
The IUPAC name of 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid (CID 62998220) is 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid.
What is the SMILES notation for 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid?
The canonical SMILES for 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid is O=C(O)c1cc(NS(=O)(=O)C2CC2)ccc1Cl.
What is the InChIKey of 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid?
The InChIKey is ZXVBADCIQYQKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO4S/c11-9-4-1-6(5-8(9)10(13)14)12-17(15,16)7-2-3-7/h1,4-5,7,12H,2-3H2,(H,13,14).
What are the key properties of 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid?
2-chloro-5-(cyclopropylsulfonylamino)benzoic acid has a molecular weight of 275.71 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(cyclopropylsulfonylamino)benzoic acid is sourced from PubChem (CID 62998220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).