C9H9BrClNO6S2 — CID 80577574
(2S)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pentanedioic acid (PubChem CID 80577574) has the molecular formula C9H9BrClNO6S2 and a molecular weight of 406.66 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 80577574 |
| Molecular Formula | C9H9BrClNO6S2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 404.87 |
| IUPAC Name | (2S)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NS(=O)(=O)c1cc(Cl)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H9BrClNO6S2/c10-8-4(11)3-7(19-8)20(17,18)12-5(9(15)16)1-2-6(13)14/h3,5,12H,1-2H2,(H,13,14)(H,15,16)/t5-/m0/s1 |
| InChIKey | SIEFAYCPOKJLDR-YFKPBYRVSA-N |
| XLogP | 1.76 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |