C11H11BrN2O4S — CID 122067629
4-[(5-bromo-2-cyanophenyl)sulfonylamino]butanoic acid (PubChem CID 122067629) has the molecular formula C11H11BrN2O4S and a molecular weight of 347.19 g/mol. Its IUPAC name is 4-[(5-bromo-2-cyanophenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[(5-bromo-2-cyanophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 122067629 |
| Molecular Formula | C11H11BrN2O4S |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 4-[(5-bromo-2-cyanophenyl)sulfonylamino]butanoic acid |
| SMILES | N#Cc1ccc(Br)cc1S(=O)(=O)NCCCC(=O)O |
| InChI | InChI=1S/C11H11BrN2O4S/c12-9-4-3-8(7-13)10(6-9)19(17,18)14-5-1-2-11(15)16/h3-4,6,14H,1-2,5H2,(H,15,16) |
| InChIKey | SSNQPXWLZUYMOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|