C14H22BrNO2S — CID 106025735
2-bromo-N-octan-4-ylbenzenesulfonamide (PubChem CID 106025735) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-bromo-N-octan-4-ylbenzenesulfonamide.
| Compound Name | 2-bromo-N-octan-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106025735 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-bromo-N-octan-4-ylbenzenesulfonamide |
| SMILES | CCCCC(CCC)NS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C14H22BrNO2S/c1-3-5-9-12(8-4-2)16-19(17,18)14-11-7-6-10-13(14)15/h6-7,10-12,16H,3-5,8-9H2,1-2H3 |
| InChIKey | WTICZJIEKDJNLG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |