C12H16Cl2N2O3S — CID 63726263
4-amino-2,6-dichloro-N-(oxan-4-ylmethyl)benzenesulfonamide (PubChem CID 63726263) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(oxan-4-ylmethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(oxan-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63726263 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(oxan-4-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)NCC2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O3S/c13-10-5-9(15)6-11(14)12(10)20(17,18)16-7-8-1-3-19-4-2-8/h5-6,8,16H,1-4,7,15H2 |
| InChIKey | YJHAICSPVZLCRF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|