C13H21FN2O2S — CID 106327934
5-amino-3-fluoro-2-methyl-N-(3-methylpentan-3-yl)benzenesulfonamide (PubChem CID 106327934) has the molecular formula C13H21FN2O2S and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-amino-3-fluoro-2-methyl-N-(3-methylpentan-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-3-fluoro-2-methyl-N-(3-methylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106327934 |
| Molecular Formula | C13H21FN2O2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-amino-3-fluoro-2-methyl-N-(3-methylpentan-3-yl)benzenesulfonamide |
| SMILES | CCC(C)(CC)NS(=O)(=O)c1cc(N)cc(F)c1C |
| InChI | InChI=1S/C13H21FN2O2S/c1-5-13(4,6-2)16-19(17,18)12-8-10(15)7-11(14)9(12)3/h7-8,16H,5-6,15H2,1-4H3 |
| InChIKey | WUHLGOFRIAQKJW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|