C13H18FNO5S — CID 64551365
3-fluoro-5-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 64551365) has the molecular formula C13H18FNO5S and a molecular weight of 319.35 g/mol. Its IUPAC name is 3-fluoro-5-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-fluoro-5-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 64551365 |
| Molecular Formula | C13H18FNO5S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-fluoro-5-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | CCC(C)(CO)NS(=O)(=O)c1cc(C(=O)O)cc(F)c1C |
| InChI | InChI=1S/C13H18FNO5S/c1-4-13(3,7-16)15-21(19,20)11-6-9(12(17)18)5-10(14)8(11)2/h5-6,15-16H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | MUCXHHFAZFDCPY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |