C11H14FNO6S — CID 66168902
3-(2,3-dihydroxypropylsulfamoyl)-5-fluoro-4-methylbenzoic acid (PubChem CID 66168902) has the molecular formula C11H14FNO6S and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfamoyl)-5-fluoro-4-methylbenzoic acid.
| Compound Name | 3-(2,3-dihydroxypropylsulfamoyl)-5-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 66168902 |
| Molecular Formula | C11H14FNO6S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfamoyl)-5-fluoro-4-methylbenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)cc1S(=O)(=O)NCC(O)CO |
| InChI | InChI=1S/C11H14FNO6S/c1-6-9(12)2-7(11(16)17)3-10(6)20(18,19)13-4-8(15)5-14/h2-3,8,13-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | OMTSOWMRWLJONQ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |