C12H16FNO5S — CID 106840447
3-fluoro-5-(4-hydroxybutylsulfamoyl)-4-methylbenzoic acid (PubChem CID 106840447) has the molecular formula C12H16FNO5S and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-fluoro-5-(4-hydroxybutylsulfamoyl)-4-methylbenzoic acid.
| Compound Name | 3-fluoro-5-(4-hydroxybutylsulfamoyl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 106840447 |
| Molecular Formula | C12H16FNO5S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-fluoro-5-(4-hydroxybutylsulfamoyl)-4-methylbenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)cc1S(=O)(=O)NCCCCO |
| InChI | InChI=1S/C12H16FNO5S/c1-8-10(13)6-9(12(16)17)7-11(8)20(18,19)14-4-2-3-5-15/h6-7,14-15H,2-5H2,1H3,(H,16,17) |
| InChIKey | JFPQHQDFNGYSJU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|