C13H19NO5S — CID 64550339
3-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 64550339) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 3-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 64550339 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-[(1-hydroxy-2-methylbutan-2-yl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | CCC(C)(CO)NS(=O)(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C13H19NO5S/c1-4-13(3,8-15)14-20(18,19)11-7-10(12(16)17)6-5-9(11)2/h5-7,14-15H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | VDTSABNSPZYUMB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |